C13H22N2O2 — CID 103950106
(2S)-2-amino-N-[1-(furan-2-yl)propan-2-yl]hexanamide (PubChem CID 103950106) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(furan-2-yl)propan-2-yl]hexanamide.
| Compound Name | (2S)-2-amino-N-[1-(furan-2-yl)propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 103950106 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (2S)-2-amino-N-[1-(furan-2-yl)propan-2-yl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)NC(C)Cc1ccco1 |
| InChI | InChI=1S/C13H22N2O2/c1-3-4-7-12(14)13(16)15-10(2)9-11-6-5-8-17-11/h5-6,8,10,12H,3-4,7,9,14H2,1-2H3,(H,15,16)/t10?,12-/m0/s1 |
| InChIKey | DFENHNGYLNHBMM-KFJBMODSSA-N |
| XLogP | 1.84 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |