C38H57N7O6 — CID 10395028
(1R,8S,11R,17S,20R,23S)-11-(4-aminobutyl)-20-benzyl-23-[(2S)-butan-2-yl]-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone (PubChem CID 10395028) has the molecular formula C38H57N7O6 and a molecular weight of 707.92 g/mol. Its IUPAC name is (1R,8S,11R,17S,20R,23S)-11-(4-aminobutyl)-20-benzyl-23-[(2S)-butan-2-yl]-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone.
| Compound Name | (1R,8S,11R,17S,20R,23S)-11-(4-aminobutyl)-20-benzyl-23-[(2S)-butan-2-yl]-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
|---|---|
| PubChem CID | 10395028 |
| Molecular Formula | C38H57N7O6 |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | (1R,8S,11R,17S,20R,23S)-11-(4-aminobutyl)-20-benzyl-23-[(2S)-butan-2-yl]-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CCCCN)NC(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C38H57N7O6/c1-3-25(2)32-38(51)45-22-12-9-18-31(45)37(50)44-21-11-8-17-29(44)34(47)40-27(16-7-10-20-39)36(49)43-23-13-19-30(43)35(48)41-28(33(46)42-32)24-26-14-5-4-6-15-26/h4-6,14-15,25,27-32H,3,7-13,16-24,39H2,1-2H3,(H,40,47)(H,41,48)(H,42,46)/t25-,27+,28+,29-,30-,31+,32-/m0/s1 |
| InChIKey | PKEOLSOHADTJNC-IRULUFEFSA-N |
| XLogP | 1.63 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|