C13H18N4O2S2 — CID 103951403
2-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-thiazole-5-sulfonamide (PubChem CID 103951403) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103951403 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCCCNCc2cccnc2)s1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-11-16-10-13(20-11)21(18,19)17-7-3-6-15-9-12-4-2-5-14-8-12/h2,4-5,8,10,15,17H,3,6-7,9H2,1H3 |
| InChIKey | FKAYBJPECBYAAS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|