C42H72O11 — CID 10395302
(8E,22E)-3,15,16,18,20-pentahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one (PubChem CID 10395302) has the molecular formula C42H72O11 and a molecular weight of 753.03 g/mol. Its IUPAC name is (8E,22E)-3,15,16,18,20-pentahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one.
| Compound Name | (8E,22E)-3,15,16,18,20-pentahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one |
|---|---|
| PubChem CID | 10395302 |
| Molecular Formula | C42H72O11 |
| Molecular Weight | 753.03 g/mol |
| Exact Mass | 752.51 |
| IUPAC Name | (8E,22E)-3,15,16,18,20-pentahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one |
| SMILES | CCC(O)CC1OC2(CCC1C)CC1OC(=O)/C=C/C(C)C(O)C(C)C(O)CC(O)C(C)(O)CCCCC/C=C/C3CC(C)(C)OC3(O)CC(O2)C1C |
| InChI | InChI=1S/C42H72O11/c1-9-31(43)21-33-26(2)18-20-41(51-33)24-34-29(5)35(52-41)25-42(49)30(23-39(6,7)53-42)15-13-11-10-12-14-19-40(8,48)36(45)22-32(44)28(4)38(47)27(3)16-17-37(46)50-34/h13,15-17,26-36,38,43-45,47-49H,9-12,14,18-25H2,1-8H3/b15-13+,17-16+ |
| InChIKey | HJEBTEQOZJFDIJ-TZSXFDEBSA-N |
| XLogP | 5.46 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|