C14H21NO4 — CID 103953323
4-[[(1-hydroxycyclohexyl)methylamino]methyl]benzene-1,2,3-triol (PubChem CID 103953323) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[[(1-hydroxycyclohexyl)methylamino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[(1-hydroxycyclohexyl)methylamino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103953323 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[[(1-hydroxycyclohexyl)methylamino]methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(CNCC2(O)CCCCC2)c(O)c1O |
| InChI | InChI=1S/C14H21NO4/c16-11-5-4-10(12(17)13(11)18)8-15-9-14(19)6-2-1-3-7-14/h4-5,15-19H,1-3,6-9H2 |
| InChIKey | USHGRFYYWAHLNB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|