C13H19NOS — CID 103953607
4-[[(3-methylsulfanylcyclopentyl)amino]methyl]phenol (PubChem CID 103953607) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 4-[[(3-methylsulfanylcyclopentyl)amino]methyl]phenol.
| Compound Name | 4-[[(3-methylsulfanylcyclopentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 103953607 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-[[(3-methylsulfanylcyclopentyl)amino]methyl]phenol |
| SMILES | CSC1CCC(NCc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C13H19NOS/c1-16-13-7-4-11(8-13)14-9-10-2-5-12(15)6-3-10/h2-3,5-6,11,13-15H,4,7-9H2,1H3 |
| InChIKey | PTMSXMRWSNMJQW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |