C9H14N4OS — CID 103953989
N'-hydroxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidine-2-carboximidamide (PubChem CID 103953989) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N'-hydroxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 103953989 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N'-hydroxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCN1Cc1cncs1 |
| InChI | InChI=1S/C9H14N4OS/c10-9(12-14)8-2-1-3-13(8)5-7-4-11-6-15-7/h4,6,8,14H,1-3,5H2,(H2,10,12) |
| InChIKey | KMOHYGBIORGQDW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|