About (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine
(4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 103954719) has the molecular formula C9H9ClFNS
and a molecular weight of 217.70 g/mol. Its IUPAC name is (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine.
Molecular Properties
| Compound Name | (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine |
| PubChem CID | 103954719 |
| Molecular Formula | C9H9ClFNS |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | N[C@@H]1CSCc2c1ccc(F)c2Cl |
| InChI | InChI=1S/C9H9ClFNS/c10-9-6-3-13-4-8(12)5(6)1-2-7(9)11/h1-2,8H,3-4,12H2/t8-/m1/s1 |
| InChIKey | DOYLLQVICWCODC-MRVPVSSYSA-N |
| XLogP | 2.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine?
The IUPAC name of (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine (CID 103954719) is (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine.
What is the SMILES notation for (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine?
The canonical SMILES for (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine is N[C@@H]1CSCc2c1ccc(F)c2Cl.
What is the InChIKey of (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine?
The InChIKey is DOYLLQVICWCODC-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9ClFNS/c10-9-6-3-13-4-8(12)5(6)1-2-7(9)11/h1-2,8H,3-4,12H2/t8-/m1/s1.
What are the key properties of (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine?
(4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine has a molecular weight of 217.70 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8-chloro-7-fluoro-3,4-dihydro-1H-isothiochromen-4-amine is sourced from PubChem (CID 103954719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).