C16H15NO4 — CID 103955438
N-(3,4-dihydro-2H-chromen-4-yl)-3,4-dihydroxybenzamide (PubChem CID 103955438) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-3,4-dihydroxybenzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103955438 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-3,4-dihydroxybenzamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H15NO4/c18-13-6-5-10(9-14(13)19)16(20)17-12-7-8-21-15-4-2-1-3-11(12)15/h1-6,9,12,18-19H,7-8H2,(H,17,20) |
| InChIKey | XOLRIYSHMSBYFJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|