C22H40O14P2 — CID 10395573
[1-acetyloxy-1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 10395573) has the molecular formula C22H40O14P2 and a molecular weight of 590.50 g/mol. Its IUPAC name is [1-acetyloxy-1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [1-acetyloxy-1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 10395573 |
| Molecular Formula | C22H40O14P2 |
| Molecular Weight | 590.50 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | [1-acetyloxy-1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(=O)OC(C)(P(=O)(O)OCOC(=O)C(C)(C)C)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H40O14P2/c1-15(23)36-22(11,37(27,28)33-12-30-16(24)19(2,3)4)38(29,34-13-31-17(25)20(5,6)7)35-14-32-18(26)21(8,9)10/h12-14H2,1-11H3,(H,27,28) |
| InChIKey | AHPOILSRGUDHJD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|