C33H33F6N5O6S3 — CID 10395574
4-[3-[2-methyl-4-[[N'-(3-phenylpropyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10395574) has the molecular formula C33H33F6N5O6S3 and a molecular weight of 805.84 g/mol. Its IUPAC name is 4-[3-[2-methyl-4-[[N'-(3-phenylpropyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[3-[2-methyl-4-[[N'-(3-phenylpropyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10395574 |
| Molecular Formula | C33H33F6N5O6S3 |
| Molecular Weight | 805.84 g/mol |
| Exact Mass | 805.15 |
| IUPAC Name | 4-[3-[2-methyl-4-[[N'-(3-phenylpropyl)carbamimidoyl]amino]phenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3ccc(N/C(N)=N/CCCc4ccccc4)cc3C)c2)c(SC)s1 |
| InChI | InChI=1S/C29H31N5O2S3.2C2HF3O2/c1-19-16-22(34-29(32)33-15-7-10-20-8-4-3-5-9-20)13-14-24(19)21-11-6-12-23(17-21)39(35,36)26-18-25(27(30)31)38-28(26)37-2;2*3-2(4,5)1(6)7/h3-6,8-9,11-14,16-18H,7,10,15H2,1-2H3,(H3,30,31)(H3,32,33,34);2*(H,6,7) |
| InChIKey | ULTLMBJOYDIJFK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 209.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|