C12H17NO3 — CID 103956449
3,4-dihydroxy-N-methyl-N-(2-methylpropyl)benzamide (PubChem CID 103956449) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3,4-dihydroxy-N-methyl-N-(2-methylpropyl)benzamide.
| Compound Name | 3,4-dihydroxy-N-methyl-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 103956449 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3,4-dihydroxy-N-methyl-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(C)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17NO3/c1-8(2)7-13(3)12(16)9-4-5-10(14)11(15)6-9/h4-6,8,14-15H,7H2,1-3H3 |
| InChIKey | IGCFOCIREKESIG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|