C11H12N2O3 — CID 103956790
N-(1-cyanopropan-2-yl)-3,4-dihydroxybenzamide (PubChem CID 103956790) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-3,4-dihydroxybenzamide.
| Compound Name | N-(1-cyanopropan-2-yl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103956790 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-3,4-dihydroxybenzamide |
| SMILES | CC(CC#N)NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H12N2O3/c1-7(4-5-12)13-11(16)8-2-3-9(14)10(15)6-8/h2-3,6-7,14-15H,4H2,1H3,(H,13,16) |
| InChIKey | LAPJVTDBAJUTHE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|