C14H14N2O3 — CID 103957153
N-ethyl-3,4-dihydroxy-N-pyridin-4-ylbenzamide (PubChem CID 103957153) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-ethyl-3,4-dihydroxy-N-pyridin-4-ylbenzamide.
| Compound Name | N-ethyl-3,4-dihydroxy-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 103957153 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-ethyl-3,4-dihydroxy-N-pyridin-4-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(O)c(O)c1)c1ccncc1 |
| InChI | InChI=1S/C14H14N2O3/c1-2-16(11-5-7-15-8-6-11)14(19)10-3-4-12(17)13(18)9-10/h3-9,17-18H,2H2,1H3 |
| InChIKey | SESMYAYFYKFHLP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|