C14H12ClNO3 — CID 103957548
N-(2-chloro-5-methylphenyl)-3,4-dihydroxybenzamide (PubChem CID 103957548) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(2-chloro-5-methylphenyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103957548 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-3,4-dihydroxybenzamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H12ClNO3/c1-8-2-4-10(15)11(6-8)16-14(19)9-3-5-12(17)13(18)7-9/h2-7,17-18H,1H3,(H,16,19) |
| InChIKey | PCIZSINSWKWWFD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|