C12H14FNO5 — CID 103957956
methyl 3-[(2-fluoro-6-methoxybenzoyl)amino]-2-hydroxypropanoate (PubChem CID 103957956) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is methyl 3-[(2-fluoro-6-methoxybenzoyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(2-fluoro-6-methoxybenzoyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103957956 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | methyl 3-[(2-fluoro-6-methoxybenzoyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1c(F)cccc1OC |
| InChI | InChI=1S/C12H14FNO5/c1-18-9-5-3-4-7(13)10(9)11(16)14-6-8(15)12(17)19-2/h3-5,8,15H,6H2,1-2H3,(H,14,16) |
| InChIKey | VDIJXINVCNADKI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |