C13H17N5S — CID 103959543
2-[2-[(1S)-1-aminopropyl]phenyl]sulfanylpyrimidine-4,6-diamine (PubChem CID 103959543) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[2-[(1S)-1-aminopropyl]phenyl]sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-[2-[(1S)-1-aminopropyl]phenyl]sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 103959543 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[2-[(1S)-1-aminopropyl]phenyl]sulfanylpyrimidine-4,6-diamine |
| SMILES | CC[C@H](N)c1ccccc1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C13H17N5S/c1-2-9(14)8-5-3-4-6-10(8)19-13-17-11(15)7-12(16)18-13/h3-7,9H,2,14H2,1H3,(H4,15,16,17,18)/t9-/m0/s1 |
| InChIKey | YSHJCZRKIBFYDR-VIFPVBQESA-N |
| XLogP | 2.20 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |