C18H21NO — CID 103959670
(1S)-1-[2-(2-methyl-2,3-dihydroindol-1-yl)phenyl]propan-1-ol (PubChem CID 103959670) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (1S)-1-[2-(2-methyl-2,3-dihydroindol-1-yl)phenyl]propan-1-ol.
| Compound Name | (1S)-1-[2-(2-methyl-2,3-dihydroindol-1-yl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 103959670 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (1S)-1-[2-(2-methyl-2,3-dihydroindol-1-yl)phenyl]propan-1-ol |
| SMILES | CC[C@H](O)c1ccccc1N1c2ccccc2CC1C |
| InChI | InChI=1S/C18H21NO/c1-3-18(20)15-9-5-7-11-17(15)19-13(2)12-14-8-4-6-10-16(14)19/h4-11,13,18,20H,3,12H2,1-2H3/t13?,18-/m0/s1 |
| InChIKey | UAHIPZZGFMLRPU-UWBLVGDVSA-N |
| XLogP | 4.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |