C17H20FNO — CID 103959822
(1R)-1-[2-[(4-fluorophenyl)methyl-methylamino]phenyl]propan-1-ol (PubChem CID 103959822) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is (1R)-1-[2-[(4-fluorophenyl)methyl-methylamino]phenyl]propan-1-ol.
| Compound Name | (1R)-1-[2-[(4-fluorophenyl)methyl-methylamino]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 103959822 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (1R)-1-[2-[(4-fluorophenyl)methyl-methylamino]phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccccc1N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FNO/c1-3-17(20)15-6-4-5-7-16(15)19(2)12-13-8-10-14(18)11-9-13/h4-11,17,20H,3,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | AOOKFJAKWYBNCJ-QGZVFWFLSA-N |
| XLogP | 3.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |