C16H17NO3 — CID 103960520
4-[2-[(1R)-1-hydroxypropyl]phenoxy]benzamide (PubChem CID 103960520) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[2-[(1R)-1-hydroxypropyl]phenoxy]benzamide.
| Compound Name | 4-[2-[(1R)-1-hydroxypropyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 103960520 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[2-[(1R)-1-hydroxypropyl]phenoxy]benzamide |
| SMILES | CC[C@@H](O)c1ccccc1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-2-14(18)13-5-3-4-6-15(13)20-12-9-7-11(8-10-12)16(17)19/h3-10,14,18H,2H2,1H3,(H2,17,19)/t14-/m1/s1 |
| InChIKey | JKUCZAWXSCMOIA-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |