C18H25N — CID 103961478
2,2,4,4,6,8-hexamethyl-3,9-dihydro-1H-carbazole (PubChem CID 103961478) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 2,2,4,4,6,8-hexamethyl-3,9-dihydro-1H-carbazole.
| Compound Name | 2,2,4,4,6,8-hexamethyl-3,9-dihydro-1H-carbazole |
|---|---|
| PubChem CID | 103961478 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2,2,4,4,6,8-hexamethyl-3,9-dihydro-1H-carbazole |
| SMILES | Cc1cc(C)c2[nH]c3c(c2c1)C(C)(C)CC(C)(C)C3 |
| InChI | InChI=1S/C18H25N/c1-11-7-12(2)16-13(8-11)15-14(19-16)9-17(3,4)10-18(15,5)6/h7-8,19H,9-10H2,1-6H3 |
| InChIKey | UBPHQBGFYQIIAH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |