C12H23N3 — CID 103961611
7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 103961611) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 103961611 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CC1(C)CC(C)(C)CC2(CN=C(N)N2)C1 |
| InChI | InChI=1S/C12H23N3/c1-10(2)5-11(3,4)7-12(6-10)8-14-9(13)15-12/h5-8H2,1-4H3,(H3,13,14,15) |
| InChIKey | BLLQUSOGKDGJCG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |