C16H22N2 — CID 103961742
4,7,7,9,9-pentamethyl-6,8-dihydropyrido[1,2-a]benzimidazole (PubChem CID 103961742) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4,7,7,9,9-pentamethyl-6,8-dihydropyrido[1,2-a]benzimidazole.
| Compound Name | 4,7,7,9,9-pentamethyl-6,8-dihydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 103961742 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4,7,7,9,9-pentamethyl-6,8-dihydropyrido[1,2-a]benzimidazole |
| SMILES | Cc1cccn2c3c(nc12)CC(C)(C)CC3(C)C |
| InChI | InChI=1S/C16H22N2/c1-11-7-6-8-18-13-12(17-14(11)18)9-15(2,3)10-16(13,4)5/h6-8H,9-10H2,1-5H3 |
| InChIKey | PYRIUDAIWBUZOX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |