About 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile
4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile (PubChem CID 103961795) has the molecular formula C11H14BrN3O
and a molecular weight of 284.16 g/mol. Its IUPAC name is 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile |
| PubChem CID | 103961795 |
| Molecular Formula | C11H14BrN3O |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCn1cc(N)c(=O)c(Br)c1 |
| InChI | InChI=1S/C11H14BrN3O/c1-11(2,7-13)3-4-15-5-8(12)10(16)9(14)6-15/h5-6H,3-4,14H2,1-2H3 |
| InChIKey | RQAOEYBKQGILNC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile?
The IUPAC name of 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile (CID 103961795) is 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile is CC(C)(C#N)CCn1cc(N)c(=O)c(Br)c1.
What is the InChIKey of 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile?
The InChIKey is RQAOEYBKQGILNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN3O/c1-11(2,7-13)3-4-15-5-8(12)10(16)9(14)6-15/h5-6H,3-4,14H2,1-2H3.
What are the key properties of 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile?
4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile has a molecular weight of 284.16 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylbutanenitrile is sourced from PubChem (CID 103961795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).