About 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid
3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid (PubChem CID 103962042) has the molecular formula C10H13BrN2O3
and a molecular weight of 289.13 g/mol. Its IUPAC name is 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid |
| PubChem CID | 103962042 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cn1cc(N)c(=O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O3/c1-10(2,9(15)16)5-13-3-6(11)8(14)7(12)4-13/h3-4H,5,12H2,1-2H3,(H,15,16) |
| InChIKey | LKMXBQJRINUPHV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid (CID 103962042) is 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid is CC(C)(Cn1cc(N)c(=O)c(Br)c1)C(=O)O.
What is the InChIKey of 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid?
The InChIKey is LKMXBQJRINUPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O3/c1-10(2,9(15)16)5-13-3-6(11)8(14)7(12)4-13/h3-4H,5,12H2,1-2H3,(H,15,16).
What are the key properties of 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid?
3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid has a molecular weight of 289.13 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-5-bromo-4-oxo-1-pyridinyl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 103962042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).