C17H24N4 — CID 103963279
4-[3-(diethylamino)pyrrolidin-1-yl]quinolin-3-amine (PubChem CID 103963279) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-[3-(diethylamino)pyrrolidin-1-yl]quinolin-3-amine.
| Compound Name | 4-[3-(diethylamino)pyrrolidin-1-yl]quinolin-3-amine |
|---|---|
| PubChem CID | 103963279 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-[3-(diethylamino)pyrrolidin-1-yl]quinolin-3-amine |
| SMILES | CCN(CC)C1CCN(c2c(N)cnc3ccccc23)C1 |
| InChI | InChI=1S/C17H24N4/c1-3-20(4-2)13-9-10-21(12-13)17-14-7-5-6-8-16(14)19-11-15(17)18/h5-8,11,13H,3-4,9-10,12,18H2,1-2H3 |
| InChIKey | XWEPUZPNHFKAHU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |