C15H15N3O — CID 103964912
2,9,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaen-8-one (PubChem CID 103964912) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 2,9,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaen-8-one.
| Compound Name | 2,9,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaen-8-one |
|---|---|
| PubChem CID | 103964912 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2,9,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaen-8-one |
| SMILES | O=C1Nc2cnc3ccccc3c2N2CCCCC12 |
| InChI | InChI=1S/C15H15N3O/c19-15-13-7-3-4-8-18(13)14-10-5-1-2-6-11(10)16-9-12(14)17-15/h1-2,5-6,9,13H,3-4,7-8H2,(H,17,19) |
| InChIKey | XXJHZLMWUIZCJW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |