C15H24ClN3 — CID 103965270
6-chloro-2-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2,3-diamine (PubChem CID 103965270) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is 6-chloro-2-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 103965270 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-chloro-2-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-2,3-diamine |
| SMILES | CC1(C)CC(Nc2nc(Cl)ccc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C15H24ClN3/c1-14(2)7-10(8-15(3,4)9-14)18-13-11(17)5-6-12(16)19-13/h5-6,10H,7-9,17H2,1-4H3,(H,18,19) |
| InChIKey | NEMSKWXJDVIUAR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|