C12H19NO4 — CID 103965499
(E)-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]-4-oxobut-2-enoic acid (PubChem CID 103965499) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (E)-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 103965499 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (E)-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C12H19NO4/c14-9-12(6-2-1-3-7-12)8-13-10(15)4-5-11(16)17/h4-5,14H,1-3,6-9H2,(H,13,15)(H,16,17)/b5-4+ |
| InChIKey | DMOHXLRXRZVNGC-SNAWJCMRSA-N |
| XLogP | 0.69 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|