C15H21FN2O3 — CID 103966376
[1-[[(5-fluoro-2-nitrophenyl)methylamino]methyl]cyclohexyl]methanol (PubChem CID 103966376) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [1-[[(5-fluoro-2-nitrophenyl)methylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(5-fluoro-2-nitrophenyl)methylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103966376 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [1-[[(5-fluoro-2-nitrophenyl)methylamino]methyl]cyclohexyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(F)cc1CNCC1(CO)CCCCC1 |
| InChI | InChI=1S/C15H21FN2O3/c16-13-4-5-14(18(20)21)12(8-13)9-17-10-15(11-19)6-2-1-3-7-15/h4-5,8,17,19H,1-3,6-7,9-11H2 |
| InChIKey | QSQYXHPAFULNHM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|