C15H23FN2 — CID 103967192
5-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine (PubChem CID 103967192) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 5-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103967192 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 5-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine |
| SMILES | CC1(C)CC(Nc2ccc(F)cn2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H23FN2/c1-14(2)7-12(8-15(3,4)10-14)18-13-6-5-11(16)9-17-13/h5-6,9,12H,7-8,10H2,1-4H3,(H,17,18) |
| InChIKey | GEYOOWIAAIZJNW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |