C15H19BrN2S — CID 103967610
N-(4-bromophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 103967610) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | N-(4-bromophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 103967610 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-(4-bromophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | Brc1ccc(NC2=NCC3(CCCCC3)CS2)cc1 |
| InChI | InChI=1S/C15H19BrN2S/c16-12-4-6-13(7-5-12)18-14-17-10-15(11-19-14)8-2-1-3-9-15/h4-7H,1-3,8-11H2,(H,17,18) |
| InChIKey | QNHFWXPJNMGDJR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |