C16H30N2S — CID 103968036
5,5-dimethyl-N-(3,3,5,5-tetramethylcyclohexyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 103968036) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 5,5-dimethyl-N-(3,3,5,5-tetramethylcyclohexyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-dimethyl-N-(3,3,5,5-tetramethylcyclohexyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 103968036 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 5,5-dimethyl-N-(3,3,5,5-tetramethylcyclohexyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CC1(C)CN=C(NC2CC(C)(C)CC(C)(C)C2)SC1 |
| InChI | InChI=1S/C16H30N2S/c1-14(2)7-12(8-15(3,4)9-14)18-13-17-10-16(5,6)11-19-13/h12H,7-11H2,1-6H3,(H,17,18) |
| InChIKey | FGQABKJDGNLWMO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |