C15H20FNO3 — CID 103968375
3-fluoro-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]benzoic acid (PubChem CID 103968375) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-fluoro-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]benzoic acid.
| Compound Name | 3-fluoro-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 103968375 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-fluoro-4-[[1-(hydroxymethyl)cyclohexyl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCC2(CO)CCCCC2)c(F)c1 |
| InChI | InChI=1S/C15H20FNO3/c16-12-8-11(14(19)20)4-5-13(12)17-9-15(10-18)6-2-1-3-7-15/h4-5,8,17-18H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | QGCZKLABVGFOAS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |