About 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine
2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 10396852) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 10396852 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCC1N=C(N)CC1C |
| InChI | InChI=1S/C7H14N2/c1-3-6-5(2)4-7(8)9-6/h5-6H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | APKCAWUHKKJFRX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine (CID 10396852) is 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine is CCC1N=C(N)CC1C.
What is the InChIKey of 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is APKCAWUHKKJFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-6-5(2)4-7(8)9-6/h5-6H,3-4H2,1-2H3,(H2,8,9).
What are the key properties of 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine?
2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 126.20 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 10396852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).