C17H31N3O — CID 103968579
2-methoxy-N-[[3-(3,3,5,5-tetramethylcyclohexyl)imidazol-4-yl]methyl]ethanamine (PubChem CID 103968579) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-methoxy-N-[[3-(3,3,5,5-tetramethylcyclohexyl)imidazol-4-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[3-(3,3,5,5-tetramethylcyclohexyl)imidazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103968579 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-methoxy-N-[[3-(3,3,5,5-tetramethylcyclohexyl)imidazol-4-yl]methyl]ethanamine |
| SMILES | COCCNCc1cncn1C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H31N3O/c1-16(2)8-14(9-17(3,4)12-16)20-13-19-11-15(20)10-18-6-7-21-5/h11,13-14,18H,6-10,12H2,1-5H3 |
| InChIKey | DFKRHNVBVCZNOC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|