About 6,7-dihydropyrrolo[3,4-b]pyridin-5-one
6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 10396890) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 10396890 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCc2ncccc21 |
| InChI | InChI=1S/C7H6N2O/c10-7-5-2-1-3-8-6(5)4-9-7/h1-3H,4H2,(H,9,10) |
| InChIKey | IPMQFUGFGHJSEI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydropyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CID 10396890) is 6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 6,7-dihydropyrrolo[3,4-b]pyridin-5-one is O=C1NCc2ncccc21.
What is the InChIKey of 6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The InChIKey is IPMQFUGFGHJSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-7-5-2-1-3-8-6(5)4-9-7/h1-3H,4H2,(H,9,10).
What are the key properties of 6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
6,7-dihydropyrrolo[3,4-b]pyridin-5-one has a molecular weight of 134.14 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydropyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 10396890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).