C18H34ClNO — CID 103969577
N-[[1-(chloromethyl)cyclohexyl]methyl]decanamide (PubChem CID 103969577) has the molecular formula C18H34ClNO and a molecular weight of 315.93 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]decanamide.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]decanamide |
|---|---|
| PubChem CID | 103969577 |
| Molecular Formula | C18H34ClNO |
| Molecular Weight | 315.93 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC1(CCl)CCCCC1 |
| InChI | InChI=1S/C18H34ClNO/c1-2-3-4-5-6-7-9-12-17(21)20-16-18(15-19)13-10-8-11-14-18/h2-16H2,1H3,(H,20,21) |
| InChIKey | LNCHZTJLZATQNJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|