About N-benzylethanimine oxide
N-benzylethanimine oxide (PubChem CID 10396978) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is N-benzylethanimine oxide.
Molecular Properties
| Compound Name | N-benzylethanimine oxide |
| PubChem CID | 10396978 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-benzylethanimine oxide |
| SMILES | C/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C9H11NO/c1-2-10(11)8-9-6-4-3-5-7-9/h2-7H,8H2,1H3/b10-2- |
| InChIKey | CANUCYHLTVBHJK-SGAXSIHGSA-N |
| XLogP | 1.79 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzylethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylethanimine oxide?
The IUPAC name of N-benzylethanimine oxide (CID 10396978) is N-benzylethanimine oxide.
What is the SMILES notation for N-benzylethanimine oxide?
The canonical SMILES for N-benzylethanimine oxide is C/C=[N+](\[O-])Cc1ccccc1.
What is the InChIKey of N-benzylethanimine oxide?
The InChIKey is CANUCYHLTVBHJK-SGAXSIHGSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-10(11)8-9-6-4-3-5-7-9/h2-7H,8H2,1H3/b10-2-.
What are the key properties of N-benzylethanimine oxide?
N-benzylethanimine oxide has a molecular weight of 149.19 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylethanimine oxide is sourced from PubChem (CID 10396978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).