C12H21BrF3NO2S — CID 103969973
N-[[1-(bromomethyl)cyclohexyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 103969973) has the molecular formula C12H21BrF3NO2S and a molecular weight of 380.27 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclohexyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 103969973 |
| Molecular Formula | C12H21BrF3NO2S |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCC1(CBr)CCCCC1 |
| InChI | InChI=1S/C12H21BrF3NO2S/c13-9-11(5-2-1-3-6-11)10-17-20(18,19)8-4-7-12(14,15)16/h17H,1-10H2 |
| InChIKey | LLAZQCSGMBPUCV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|