About [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate
[(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10397074) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 10397074 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1CO1 |
| InChI | InChI=1S/C8H14O3/c1-8(2,3)7(9)11-5-6-4-10-6/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | CBLGECFNLBWONR-ZCFIWIBFSA-N |
| XLogP | 0.97 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate (CID 10397074) is [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC[C@H]1CO1.
What is the InChIKey of [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is CBLGECFNLBWONR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14O3/c1-8(2,3)7(9)11-5-6-4-10-6/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate?
[(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 158.20 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxiran-2-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 10397074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).