C9H15NO — CID 103970857
1-(1,5-dimethylpyrrolidin-3-ylidene)propan-2-one (PubChem CID 103970857) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrrolidin-3-ylidene)propan-2-one.
| Compound Name | 1-(1,5-dimethylpyrrolidin-3-ylidene)propan-2-one |
|---|---|
| PubChem CID | 103970857 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-(1,5-dimethylpyrrolidin-3-ylidene)propan-2-one |
| SMILES | CC(=O)C=C1CC(C)N(C)C1 |
| InChI | InChI=1S/C9H15NO/c1-7-4-9(5-8(2)11)6-10(7)3/h5,7H,4,6H2,1-3H3 |
| InChIKey | QXVGEOSYCVOFBZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|