C11H18O — CID 103970997
1-(2,3-dimethylcyclohexylidene)propan-2-one (PubChem CID 103970997) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexylidene)propan-2-one.
| Compound Name | 1-(2,3-dimethylcyclohexylidene)propan-2-one |
|---|---|
| PubChem CID | 103970997 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 1-(2,3-dimethylcyclohexylidene)propan-2-one |
| SMILES | CC(=O)C=C1CCCC(C)C1C |
| InChI | InChI=1S/C11H18O/c1-8-5-4-6-11(10(8)3)7-9(2)12/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | DFSXSMUWRVHXMY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|