About (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol
(1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol (PubChem CID 103971366) has the molecular formula C7H12O3S
and a molecular weight of 176.24 g/mol. Its IUPAC name is (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol.
Molecular Properties
| Compound Name | (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol |
| PubChem CID | 103971366 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol |
| SMILES | CC(O)/C=C1/CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12O3S/c1-6(8)4-7-2-3-11(9,10)5-7/h4,6,8H,2-3,5H2,1H3/b7-4- |
| InChIKey | YKOUYRFDWKKIIB-DAXSKMNVSA-N |
| XLogP | 0.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol?
The IUPAC name of (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol (CID 103971366) is (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol.
What is the SMILES notation for (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol?
The canonical SMILES for (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol is CC(O)/C=C1/CCS(=O)(=O)C1.
What is the InChIKey of (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol?
The InChIKey is YKOUYRFDWKKIIB-DAXSKMNVSA-N. The full InChI is InChI=1S/C7H12O3S/c1-6(8)4-7-2-3-11(9,10)5-7/h4,6,8H,2-3,5H2,1H3/b7-4-.
What are the key properties of (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol?
(1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol has a molecular weight of 176.24 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(1,1-dioxothiolan-3-ylidene)propan-2-ol is sourced from PubChem (CID 103971366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).