C13H14ClN3O2 — CID 103971569
3-[5-(2-chloro-3-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971569) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-[5-(2-chloro-3-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 3-[5-(2-chloro-3-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971569 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-[5-(2-chloro-3-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | Cc1cccc(-c2nc(C3COCCN3)no2)c1Cl |
| InChI | InChI=1S/C13H14ClN3O2/c1-8-3-2-4-9(11(8)14)13-16-12(17-19-13)10-7-18-6-5-15-10/h2-4,10,15H,5-7H2,1H3 |
| InChIKey | KNRUEPYGWBYJGT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |