C8H9NO3 — CID 10397167
[(1S,4R)-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl]methyl acetate (PubChem CID 10397167) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is [(1S,4R)-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl]methyl acetate.
| Compound Name | [(1S,4R)-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10397167 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | [(1S,4R)-3-oxo-2-azabicyclo[2.2.0]hex-5-en-2-yl]methyl acetate |
| SMILES | CC(=O)OCN1C(=O)[C@@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C8H9NO3/c1-5(10)12-4-9-7-3-2-6(7)8(9)11/h2-3,6-7H,4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | GXSJRBRMMIXTEY-RQJHMYQMSA-N |
| XLogP | -0.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|