C13H14BrN3O2 — CID 103971809
2-[5-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971809) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-[5-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 2-[5-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971809 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[5-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | Cc1ccc(-c2nc(C3CNCCO3)no2)cc1Br |
| InChI | InChI=1S/C13H14BrN3O2/c1-8-2-3-9(6-10(8)14)13-16-12(17-19-13)11-7-15-4-5-18-11/h2-3,6,11,15H,4-5,7H2,1H3 |
| InChIKey | HGVYZSAXHKXDGN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |