About diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate
diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate (PubChem CID 103972507) has the molecular formula C13H22O7S
and a molecular weight of 322.38 g/mol. Its IUPAC name is diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate |
| PubChem CID | 103972507 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate |
| SMILES | CCOC(=O)C(CCO)(C(=O)OCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22O7S/c1-3-19-11(15)13(6-7-14,12(16)20-4-2)10-5-8-21(17,18)9-10/h10,14H,3-9H2,1-2H3 |
| InChIKey | PQSHAMMOYWRZSO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate?
The IUPAC name of diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate (CID 103972507) is diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate.
What is the SMILES notation for diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate?
The canonical SMILES for diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate is CCOC(=O)C(CCO)(C(=O)OCC)C1CCS(=O)(=O)C1.
What is the InChIKey of diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate?
The InChIKey is PQSHAMMOYWRZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O7S/c1-3-19-11(15)13(6-7-14,12(16)20-4-2)10-5-8-21(17,18)9-10/h10,14H,3-9H2,1-2H3.
What are the key properties of diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate?
diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate has a molecular weight of 322.38 g/mol, XLogP of -0.08, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethyl)propanedioate is sourced from PubChem (CID 103972507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).