About 6-prop-2-enoxyhexane-1,2-diol
6-prop-2-enoxyhexane-1,2-diol (PubChem CID 10397275) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 6-prop-2-enoxyhexane-1,2-diol.
Molecular Properties
| Compound Name | 6-prop-2-enoxyhexane-1,2-diol |
| PubChem CID | 10397275 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 6-prop-2-enoxyhexane-1,2-diol |
| SMILES | C=CCOCCCCC(O)CO |
| InChI | InChI=1S/C9H18O3/c1-2-6-12-7-4-3-5-9(11)8-10/h2,9-11H,1,3-8H2 |
| InChIKey | VLQGQNNONKOTPS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enoxyhexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enoxyhexane-1,2-diol?
The IUPAC name of 6-prop-2-enoxyhexane-1,2-diol (CID 10397275) is 6-prop-2-enoxyhexane-1,2-diol.
What is the SMILES notation for 6-prop-2-enoxyhexane-1,2-diol?
The canonical SMILES for 6-prop-2-enoxyhexane-1,2-diol is C=CCOCCCCC(O)CO.
What is the InChIKey of 6-prop-2-enoxyhexane-1,2-diol?
The InChIKey is VLQGQNNONKOTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-2-6-12-7-4-3-5-9(11)8-10/h2,9-11H,1,3-8H2.
What are the key properties of 6-prop-2-enoxyhexane-1,2-diol?
6-prop-2-enoxyhexane-1,2-diol has a molecular weight of 174.24 g/mol, XLogP of 0.71, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enoxyhexane-1,2-diol is sourced from PubChem (CID 10397275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).