C13H21N3O4 — CID 103973062
diethyl 2-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]propanedioate (PubChem CID 103973062) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is diethyl 2-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]propanedioate.
| Compound Name | diethyl 2-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 103973062 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | diethyl 2-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(CC)(Cc1ncnn1C)C(=O)OCC |
| InChI | InChI=1S/C13H21N3O4/c1-5-13(11(17)19-6-2,12(18)20-7-3)8-10-14-9-15-16(10)4/h9H,5-8H2,1-4H3 |
| InChIKey | NLCWRJOPEVLGOM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|